C15H20F2O2 — CID 103165491
1-(2,4-difluoro-5-methylphenyl)-2-(3-ethoxycyclobutyl)ethanol (PubChem CID 103165491) has the molecular formula C15H20F2O2 and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-2-(3-ethoxycyclobutyl)ethanol.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-2-(3-ethoxycyclobutyl)ethanol |
|---|---|
| PubChem CID | 103165491 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-2-(3-ethoxycyclobutyl)ethanol |
| SMILES | CCOC1CC(CC(O)c2cc(C)c(F)cc2F)C1 |
| InChI | InChI=1S/C15H20F2O2/c1-3-19-11-5-10(6-11)7-15(18)12-4-9(2)13(16)8-14(12)17/h4,8,10-11,15,18H,3,5-7H2,1-2H3 |
| InChIKey | ICFARZLIIPJEHU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |