C21H14O6 — CID 10316565
2-[(2,4-dihydroxyphenyl)methyl]-1,8-dihydroxyanthracene-9,10-dione (PubChem CID 10316565) has the molecular formula C21H14O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)methyl]-1,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-[(2,4-dihydroxyphenyl)methyl]-1,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 10316565 |
| Molecular Formula | C21H14O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[(2,4-dihydroxyphenyl)methyl]-1,8-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c1ccc(Cc1ccc(O)cc1O)c2O |
| InChI | InChI=1S/C21H14O6/c22-12-6-4-10(16(24)9-12)8-11-5-7-14-18(19(11)25)21(27)17-13(20(14)26)2-1-3-15(17)23/h1-7,9,22-25H,8H2 |
| InChIKey | JBYMUURTXIACAF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|