About 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid
5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid (PubChem CID 10316566) has the molecular formula C20H14N2O5
and a molecular weight of 362.34 g/mol. Its IUPAC name is 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid |
| PubChem CID | 10316566 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1 |
| InChI | InChI=1S/C20H14N2O5/c23-20(24)16-7-6-15(27-16)19-13-8-17-18(26-11-25-17)9-14(13)22(21-19)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,23,24) |
| InChIKey | HBCONDBJRIAUAS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid?
The IUPAC name of 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid (CID 10316566) is 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid.
What is the SMILES notation for 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid?
The canonical SMILES for 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid is O=C(O)c1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1.
What is the InChIKey of 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid?
The InChIKey is HBCONDBJRIAUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O5/c23-20(24)16-7-6-15(27-16)19-13-8-17-18(26-11-25-17)9-14(13)22(21-19)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,23,24).
What are the key properties of 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid?
5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid has a molecular weight of 362.34 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylic acid is sourced from PubChem (CID 10316566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).