C15H20Br2O2 — CID 103165706
4-bromo-2-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1-methoxybenzene (PubChem CID 103165706) has the molecular formula C15H20Br2O2 and a molecular weight of 392.13 g/mol. Its IUPAC name is 4-bromo-2-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1-methoxybenzene.
| Compound Name | 4-bromo-2-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1-methoxybenzene |
|---|---|
| PubChem CID | 103165706 |
| Molecular Formula | C15H20Br2O2 |
| Molecular Weight | 392.13 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 4-bromo-2-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1-methoxybenzene |
| SMILES | CCOC1CC(CC(Br)c2cc(Br)ccc2OC)C1 |
| InChI | InChI=1S/C15H20Br2O2/c1-3-19-12-6-10(7-12)8-14(17)13-9-11(16)4-5-15(13)18-2/h4-5,9-10,12,14H,3,6-8H2,1-2H3 |
| InChIKey | NDZBHERQRJJIQI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.13 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|