C21H18N2O4 — CID 10316572
5-ethyl-5-hydroxy-16-methoxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione (PubChem CID 10316572) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-ethyl-5-hydroxy-16-methoxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione.
| Compound Name | 5-ethyl-5-hydroxy-16-methoxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione |
|---|---|
| PubChem CID | 10316572 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-ethyl-5-hydroxy-16-methoxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione |
| SMILES | CCC1(O)C(=O)Cc2c1cc1n(c2=O)Cc2cc3cc(OC)ccc3nc2-1 |
| InChI | InChI=1S/C21H18N2O4/c1-3-21(26)15-9-17-19-12(10-23(17)20(25)14(15)8-18(21)24)6-11-7-13(27-2)4-5-16(11)22-19/h4-7,9,26H,3,8,10H2,1-2H3 |
| InChIKey | XAQKCDAFPAOWPB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |