C14H13Cl2FN2O2S — CID 10316621
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1,3-thiazol-5-yl)phenyl]propan-2-yl]acetamide (PubChem CID 10316621) has the molecular formula C14H13Cl2FN2O2S and a molecular weight of 363.24 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1,3-thiazol-5-yl)phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1,3-thiazol-5-yl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 10316621 |
| Molecular Formula | C14H13Cl2FN2O2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1,3-thiazol-5-yl)phenyl]propan-2-yl]acetamide |
| SMILES | O=C(N[C@H](CF)[C@H](O)c1ccc(-c2cncs2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C14H13Cl2FN2O2S/c15-13(16)14(21)19-10(5-17)12(20)9-3-1-8(2-4-9)11-6-18-7-22-11/h1-4,6-7,10,12-13,20H,5H2,(H,19,21)/t10-,12-/m1/s1 |
| InChIKey | JVLJRSUQPISLDM-ZYHUDNBSSA-N |
| XLogP | 3.10 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|