About N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide
N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide (PubChem CID 103166308) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide.
Molecular Properties
| Compound Name | N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide |
| PubChem CID | 103166308 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide |
| SMILES | CCC/N=C(/CC1CC(OCC)C1)NN |
| InChI | InChI=1S/C11H23N3O/c1-3-5-13-11(14-12)8-9-6-10(7-9)15-4-2/h9-10H,3-8,12H2,1-2H3,(H,13,14) |
| InChIKey | WRHOQPBGSPSILZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide?
The IUPAC name of N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide (CID 103166308) is N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide.
What is the SMILES notation for N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide?
The canonical SMILES for N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide is CCC/N=C(/CC1CC(OCC)C1)NN.
What is the InChIKey of N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide?
The InChIKey is WRHOQPBGSPSILZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-3-5-13-11(14-12)8-9-6-10(7-9)15-4-2/h9-10H,3-8,12H2,1-2H3,(H,13,14).
What are the key properties of N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide?
N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide has a molecular weight of 213.32 g/mol, XLogP of 1.46, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-2-(3-ethoxycyclobutyl)-N'-propylethanimidamide is sourced from PubChem (CID 103166308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).