C16H24ClNO2 — CID 103167190
4-amino-3-(4-chlorophenyl)-1-(3-ethoxycyclobutyl)butan-2-ol (PubChem CID 103167190) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 4-amino-3-(4-chlorophenyl)-1-(3-ethoxycyclobutyl)butan-2-ol.
| Compound Name | 4-amino-3-(4-chlorophenyl)-1-(3-ethoxycyclobutyl)butan-2-ol |
|---|---|
| PubChem CID | 103167190 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-amino-3-(4-chlorophenyl)-1-(3-ethoxycyclobutyl)butan-2-ol |
| SMILES | CCOC1CC(CC(O)C(CN)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H24ClNO2/c1-2-20-14-7-11(8-14)9-16(19)15(10-18)12-3-5-13(17)6-4-12/h3-6,11,14-16,19H,2,7-10,18H2,1H3 |
| InChIKey | JHXFHRROWYBBTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |