About 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride
4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103167664) has the molecular formula C11H18ClN3O2S
and a molecular weight of 291.80 g/mol. Its IUPAC name is 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride |
| PubChem CID | 103167664 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CC(C)(C)n1c(CC2CCC2)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H18ClN3O2S/c1-11(2,3)15-9(7-8-5-4-6-8)13-14-10(15)18(12,16)17/h8H,4-7H2,1-3H3 |
| InChIKey | HKVGPRZJWLLWPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride (CID 103167664) is 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride is CC(C)(C)n1c(CC2CCC2)nnc1S(=O)(=O)Cl.
What is the InChIKey of 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is HKVGPRZJWLLWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3O2S/c1-11(2,3)15-9(7-8-5-4-6-8)13-14-10(15)18(12,16)17/h8H,4-7H2,1-3H3.
What are the key properties of 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride?
4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 291.80 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-5-(cyclobutylmethyl)-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 103167664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).