5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride

C9H14ClN3O2S — CID 103167666

IUPAC5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride
SMILESCCn1c(CC2CCC2)nnc1S(=O)(=O)Cl
InChIInChI=1S/C9H14ClN3O2S/c1-2-13-8(6-7-4-3-5-7)11-12-9(13)16(10,14)15/h7H,2-6H2,1H3
InChIKeyFTRKCQZIFJLRMO-UHFFFAOYSA-N
MW263.75 g/mol
LogP1.57
Rot. Bonds4

About 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride

5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103167666) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride.

Molecular Properties

Compound Name5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride
PubChem CID103167666
Molecular FormulaC9H14ClN3O2S
Molecular Weight263.75 g/mol
Exact Mass263.05
IUPAC Name5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride
SMILESCCn1c(CC2CCC2)nnc1S(=O)(=O)Cl
InChIInChI=1S/C9H14ClN3O2S/c1-2-13-8(6-7-4-3-5-7)11-12-9(13)16(10,14)15/h7H,2-6H2,1H3
InChIKeyFTRKCQZIFJLRMO-UHFFFAOYSA-N
XLogP1.57
TPSA64.85 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.75
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride (CID 103167666) is 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride is CCn1c(CC2CCC2)nnc1S(=O)(=O)Cl.
What is the InChIKey of 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is FTRKCQZIFJLRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3O2S/c1-2-13-8(6-7-4-3-5-7)11-12-9(13)16(10,14)15/h7H,2-6H2,1H3.
What are the key properties of 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride?
5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 263.75 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclobutylmethyl)-4-ethyl-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 103167666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).