C18H24O2 — CID 103168158
1-(3-cyclobutylphenyl)-2-(3-ethoxycyclobutyl)ethanone (PubChem CID 103168158) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-2-(3-ethoxycyclobutyl)ethanone.
| Compound Name | 1-(3-cyclobutylphenyl)-2-(3-ethoxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 103168158 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-2-(3-ethoxycyclobutyl)ethanone |
| SMILES | CCOC1CC(CC(=O)c2cccc(C3CCC3)c2)C1 |
| InChI | InChI=1S/C18H24O2/c1-2-20-17-9-13(10-17)11-18(19)16-8-4-7-15(12-16)14-5-3-6-14/h4,7-8,12-14,17H,2-3,5-6,9-11H2,1H3 |
| InChIKey | QLAQHNNZOGOJNK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |