C11H19NO — CID 103169437
2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanamine (PubChem CID 103169437) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanamine.
| Compound Name | 2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanamine |
|---|---|
| PubChem CID | 103169437 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanamine |
| SMILES | NC(CC1CCC1)C1=COCCC1 |
| InChI | InChI=1S/C11H19NO/c12-11(7-9-3-1-4-9)10-5-2-6-13-8-10/h8-9,11H,1-7,12H2 |
| InChIKey | AHFNTSDOEQKUKJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |