C12H18N2O3 — CID 103170218
2-cyclobutyl-1-(3,5-dimethoxypyrazin-2-yl)ethanol (PubChem CID 103170218) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-cyclobutyl-1-(3,5-dimethoxypyrazin-2-yl)ethanol.
| Compound Name | 2-cyclobutyl-1-(3,5-dimethoxypyrazin-2-yl)ethanol |
|---|---|
| PubChem CID | 103170218 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-cyclobutyl-1-(3,5-dimethoxypyrazin-2-yl)ethanol |
| SMILES | COc1cnc(C(O)CC2CCC2)c(OC)n1 |
| InChI | InChI=1S/C12H18N2O3/c1-16-10-7-13-11(12(14-10)17-2)9(15)6-8-4-3-5-8/h7-9,15H,3-6H2,1-2H3 |
| InChIKey | PSBMGSQYHIOTDR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |