About [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine
[1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine (PubChem CID 103170477) has the molecular formula C15H22F2N2O
and a molecular weight of 284.35 g/mol. Its IUPAC name is [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine |
| PubChem CID | 103170477 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine |
| SMILES | CCOC1CC(CC(Cc2cccc(F)c2F)NN)C1 |
| InChI | InChI=1S/C15H22F2N2O/c1-2-20-13-7-10(8-13)6-12(19-18)9-11-4-3-5-14(16)15(11)17/h3-5,10,12-13,19H,2,6-9,18H2,1H3 |
| InChIKey | KAENTZOJJCWTHA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine?
The IUPAC name of [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine (CID 103170477) is [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine.
What is the SMILES notation for [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine?
The canonical SMILES for [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine is CCOC1CC(CC(Cc2cccc(F)c2F)NN)C1.
What is the InChIKey of [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine?
The InChIKey is KAENTZOJJCWTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N2O/c1-2-20-13-7-10(8-13)6-12(19-18)9-11-4-3-5-14(16)15(11)17/h3-5,10,12-13,19H,2,6-9,18H2,1H3.
What are the key properties of [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine?
[1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine has a molecular weight of 284.35 g/mol, XLogP of 2.54, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-difluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine is sourced from PubChem (CID 103170477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).