C11H15F3N2O2S — CID 103171199
2-amino-N,3,6-trimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 103171199) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-amino-N,3,6-trimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-amino-N,3,6-trimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103171199 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-amino-N,3,6-trimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)CC(F)(F)F)c1N |
| InChI | InChI=1S/C11H15F3N2O2S/c1-7-4-5-8(2)10(9(7)15)19(17,18)16(3)6-11(12,13)14/h4-5H,6,15H2,1-3H3 |
| InChIKey | ALIMEASDKCAIJQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|