C12H17F3N2O3S — CID 103171518
2-amino-3,6-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 103171518) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-amino-3,6-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-3,6-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103171518 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-amino-3,6-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCOCC(F)(F)F)c1N |
| InChI | InChI=1S/C12H17F3N2O3S/c1-8-3-4-9(2)11(10(8)16)21(18,19)17-5-6-20-7-12(13,14)15/h3-4,17H,5-7,16H2,1-2H3 |
| InChIKey | RAUIURSHYYIYIS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|