About 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide
2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide (PubChem CID 103171685) has the molecular formula C10H14F2N2O2S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide |
| PubChem CID | 103171685 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC(F)F)c1N |
| InChI | InChI=1S/C10H14F2N2O2S/c1-6-3-4-7(2)10(9(6)13)17(15,16)14-5-8(11)12/h3-4,8,14H,5,13H2,1-2H3 |
| InChIKey | BZIGKKRMUBGROP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide?
The IUPAC name of 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide (CID 103171685) is 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide.
What is the SMILES notation for 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide?
The canonical SMILES for 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide is Cc1ccc(C)c(S(=O)(=O)NCC(F)F)c1N.
What is the InChIKey of 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide?
The InChIKey is BZIGKKRMUBGROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O2S/c1-6-3-4-7(2)10(9(6)13)17(15,16)14-5-8(11)12/h3-4,8,14H,5,13H2,1-2H3.
What are the key properties of 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide?
2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide has a molecular weight of 264.30 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2-difluoroethyl)-3,6-dimethylbenzenesulfonamide is sourced from PubChem (CID 103171685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).