C13H19F3N2O2S — CID 103171688
2-amino-3,6-dimethyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 103171688) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-amino-3,6-dimethyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 2-amino-3,6-dimethyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103171688 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-amino-3,6-dimethyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCCCC(F)(F)F)c1N |
| InChI | InChI=1S/C13H19F3N2O2S/c1-9-5-6-10(2)12(11(9)17)21(19,20)18-8-4-3-7-13(14,15)16/h5-6,18H,3-4,7-8,17H2,1-2H3 |
| InChIKey | IJUTXVFVWCFLGZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|