C11H16F2N2O2S — CID 103171820
2-amino-N-(2,2-difluoroethyl)-N,3,6-trimethylbenzenesulfonamide (PubChem CID 103171820) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-N,3,6-trimethylbenzenesulfonamide.
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-N,3,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 103171820 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-N,3,6-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)CC(F)F)c1N |
| InChI | InChI=1S/C11H16F2N2O2S/c1-7-4-5-8(2)11(10(7)14)18(16,17)15(3)6-9(12)13/h4-5,9H,6,14H2,1-3H3 |
| InChIKey | FRFHRQBIFQEIRV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|