About [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine
[1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine (PubChem CID 103171952) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine.
Molecular Properties
| Compound Name | [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine |
| PubChem CID | 103171952 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine |
| SMILES | COc1ccnc(COC2(CN)CCC(C)C2)c1OC |
| InChI | InChI=1S/C15H24N2O3/c1-11-4-6-15(8-11,10-16)20-9-12-14(19-3)13(18-2)5-7-17-12/h5,7,11H,4,6,8-10,16H2,1-3H3 |
| InChIKey | WGDCDXXDKBQUEH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine?
The IUPAC name of [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine (CID 103171952) is [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine.
What is the SMILES notation for [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine?
The canonical SMILES for [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine is COc1ccnc(COC2(CN)CCC(C)C2)c1OC.
What is the InChIKey of [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine?
The InChIKey is WGDCDXXDKBQUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-11-4-6-15(8-11,10-16)20-9-12-14(19-3)13(18-2)5-7-17-12/h5,7,11H,4,6,8-10,16H2,1-3H3.
What are the key properties of [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine?
[1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine has a molecular weight of 280.37 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,4-dimethoxy-2-pyridinyl)methoxy]-3-methylcyclopentyl]methanamine is sourced from PubChem (CID 103171952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).