About 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile
3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile (PubChem CID 103172838) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile.
Molecular Properties
| Compound Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile |
| PubChem CID | 103172838 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile |
| SMILES | COc1ccnc(CN(C)C(C)CC#N)c1OC |
| InChI | InChI=1S/C13H19N3O2/c1-10(5-7-14)16(2)9-11-13(18-4)12(17-3)6-8-15-11/h6,8,10H,5,9H2,1-4H3 |
| InChIKey | PNETZHOIGQQPCL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile?
The IUPAC name of 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile (CID 103172838) is 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile.
What is the SMILES notation for 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile?
The canonical SMILES for 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile is COc1ccnc(CN(C)C(C)CC#N)c1OC.
What is the InChIKey of 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile?
The InChIKey is PNETZHOIGQQPCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-10(5-7-14)16(2)9-11-13(18-4)12(17-3)6-8-15-11/h6,8,10H,5,9H2,1-4H3.
What are the key properties of 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile?
3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile has a molecular weight of 249.31 g/mol, XLogP of 1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethoxy-2-pyridinyl)methyl-methylamino]butanenitrile is sourced from PubChem (CID 103172838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).