C13H19NO6S — CID 103172933
methyl 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfonyl]butanoate (PubChem CID 103172933) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is methyl 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfonyl]butanoate.
| Compound Name | methyl 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfonyl]butanoate |
|---|---|
| PubChem CID | 103172933 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfonyl]butanoate |
| SMILES | COC(=O)CC(C)S(=O)(=O)Cc1nccc(OC)c1OC |
| InChI | InChI=1S/C13H19NO6S/c1-9(7-12(15)19-3)21(16,17)8-10-13(20-4)11(18-2)5-6-14-10/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | RVMWUNVRUHBYBQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |