C22H27ClO3 — CID 10317318
[(10S,13S,17S)-6-chloro-10,13,17-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 10317318) has the molecular formula C22H27ClO3 and a molecular weight of 374.91 g/mol. Its IUPAC name is [(10S,13S,17S)-6-chloro-10,13,17-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(10S,13S,17S)-6-chloro-10,13,17-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 10317318 |
| Molecular Formula | C22H27ClO3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(10S,13S,17S)-6-chloro-10,13,17-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C)CCC2C3C=C(Cl)C4=CC(=O)C=C[C@@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C22H27ClO3/c1-13(24)26-22(4)10-7-17-15-12-19(23)18-11-14(25)5-8-20(18,2)16(15)6-9-21(17,22)3/h5,8,11-12,15-17H,6-7,9-10H2,1-4H3/t15?,16?,17?,20-,21-,22-/m0/s1 |
| InChIKey | NGPSZBNFRDDJPV-PRCXIQSVSA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |