About 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine
2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine (PubChem CID 103173383) has the molecular formula C15H15ClFNO3
and a molecular weight of 311.74 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine.
Molecular Properties
| Compound Name | 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine |
| PubChem CID | 103173383 |
| Molecular Formula | C15H15ClFNO3 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(COc2c(F)cccc2CCl)c1OC |
| InChI | InChI=1S/C15H15ClFNO3/c1-19-13-6-7-18-12(15(13)20-2)9-21-14-10(8-16)4-3-5-11(14)17/h3-7H,8-9H2,1-2H3 |
| InChIKey | MKJXHNBVRNJJRF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine?
The IUPAC name of 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine (CID 103173383) is 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine.
What is the SMILES notation for 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine?
The canonical SMILES for 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine is COc1ccnc(COc2c(F)cccc2CCl)c1OC.
What is the InChIKey of 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine?
The InChIKey is MKJXHNBVRNJJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClFNO3/c1-19-13-6-7-18-12(15(13)20-2)9-21-14-10(8-16)4-3-5-11(14)17/h3-7H,8-9H2,1-2H3.
What are the key properties of 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine?
2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine has a molecular weight of 311.74 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-3,4-dimethoxypyridine is sourced from PubChem (CID 103173383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).