C13H20N2O3 — CID 103173413
3,4-dimethoxy-2-(pyrrolidin-3-ylmethoxymethyl)pyridine (PubChem CID 103173413) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,4-dimethoxy-2-(pyrrolidin-3-ylmethoxymethyl)pyridine.
| Compound Name | 3,4-dimethoxy-2-(pyrrolidin-3-ylmethoxymethyl)pyridine |
|---|---|
| PubChem CID | 103173413 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3,4-dimethoxy-2-(pyrrolidin-3-ylmethoxymethyl)pyridine |
| SMILES | COc1ccnc(COCC2CCNC2)c1OC |
| InChI | InChI=1S/C13H20N2O3/c1-16-12-4-6-15-11(13(12)17-2)9-18-8-10-3-5-14-7-10/h4,6,10,14H,3,5,7-9H2,1-2H3 |
| InChIKey | IHEASWIISNXKAP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |