About 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol
1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol (PubChem CID 103173833) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol |
| PubChem CID | 103173833 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(Cc1nccc(OC)c1OC)CC(C)(C)O |
| InChI | InChI=1S/C14H24N2O3/c1-6-16(10-14(2,3)17)9-11-13(19-5)12(18-4)7-8-15-11/h7-8,17H,6,9-10H2,1-5H3 |
| InChIKey | OWSRRYJRVXEPOC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol?
The IUPAC name of 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol (CID 103173833) is 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol?
The canonical SMILES for 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol is CCN(Cc1nccc(OC)c1OC)CC(C)(C)O.
What is the InChIKey of 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol?
The InChIKey is OWSRRYJRVXEPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-6-16(10-14(2,3)17)9-11-13(19-5)12(18-4)7-8-15-11/h7-8,17H,6,9-10H2,1-5H3.
What are the key properties of 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol?
1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol has a molecular weight of 268.36 g/mol, XLogP of 1.69, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxy-2-pyridinyl)methyl-ethylamino]-2-methylpropan-2-ol is sourced from PubChem (CID 103173833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).