C14H23ClN2O2 — CID 103173931
N-(2-chloroethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]butan-1-amine (PubChem CID 103173931) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]butan-1-amine.
| Compound Name | N-(2-chloroethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 103173931 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(2-chloroethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]butan-1-amine |
| SMILES | CCCCN(CCCl)Cc1nccc(OC)c1OC |
| InChI | InChI=1S/C14H23ClN2O2/c1-4-5-9-17(10-7-15)11-12-14(19-3)13(18-2)6-8-16-12/h6,8H,4-5,7,9-11H2,1-3H3 |
| InChIKey | JAOSMLLRRWISSB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|