C18H21NO4S2 — CID 10317590
4-methyl-N-[oxo-phenyl-[(2S,3R)-3-propan-2-yloxiran-2-yl]-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 10317590) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-methyl-N-[oxo-phenyl-[(2S,3R)-3-propan-2-yloxiran-2-yl]-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxo-phenyl-[(2S,3R)-3-propan-2-yloxiran-2-yl]-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 10317590 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-methyl-N-[oxo-phenyl-[(2S,3R)-3-propan-2-yloxiran-2-yl]-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccccc2)[C@@H]2O[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H21NO4S2/c1-13(2)17-18(23-17)24(20,15-7-5-4-6-8-15)19-25(21,22)16-11-9-14(3)10-12-16/h4-13,17-18H,1-3H3/t17-,18+,24?/m1/s1 |
| InChIKey | WWWHSYMSJBFWEC-IHHKOXMGSA-N |
| XLogP | 3.59 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|