About 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid
2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid (PubChem CID 10317610) has the molecular formula C23H22ClNO2
and a molecular weight of 379.89 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid |
| PubChem CID | 10317610 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid |
| SMILES | CC1(C)Cc2c(-c3ccccc3)c(-c3cccc(Cl)c3)c(CC(=O)O)n2C1 |
| InChI | InChI=1S/C23H22ClNO2/c1-23(2)13-19-21(15-7-4-3-5-8-15)22(16-9-6-10-17(24)11-16)18(12-20(26)27)25(19)14-23/h3-11H,12-14H2,1-2H3,(H,26,27) |
| InChIKey | SCAZIULVPRWXGG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid?
The IUPAC name of 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid (CID 10317610) is 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid.
What is the SMILES notation for 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid?
The canonical SMILES for 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid is CC1(C)Cc2c(-c3ccccc3)c(-c3cccc(Cl)c3)c(CC(=O)O)n2C1.
What is the InChIKey of 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid?
The InChIKey is SCAZIULVPRWXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClNO2/c1-23(2)13-19-21(15-7-4-3-5-8-15)22(16-9-6-10-17(24)11-16)18(12-20(26)27)25(19)14-23/h3-11H,12-14H2,1-2H3,(H,26,27).
What are the key properties of 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid?
2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid has a molecular weight of 379.89 g/mol, XLogP of 5.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid is sourced from PubChem (CID 10317610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).