About [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol
[4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol (PubChem CID 10317643) has the molecular formula C22H25FN4O
and a molecular weight of 380.47 g/mol. Its IUPAC name is [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol |
| PubChem CID | 10317643 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol |
| SMILES | CC1CN(c2ccc(Nc3c(CO)cnc4ccc(F)cc34)cc2)CCN1C |
| InChI | InChI=1S/C22H25FN4O/c1-15-13-27(10-9-26(15)2)19-6-4-18(5-7-19)25-22-16(14-28)12-24-21-8-3-17(23)11-20(21)22/h3-8,11-12,15,28H,9-10,13-14H2,1-2H3,(H,24,25) |
| InChIKey | RLNXYUWOYNTOTQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol?
The IUPAC name of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol (CID 10317643) is [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol.
What is the SMILES notation for [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol?
The canonical SMILES for [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol is CC1CN(c2ccc(Nc3c(CO)cnc4ccc(F)cc34)cc2)CCN1C.
What is the InChIKey of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol?
The InChIKey is RLNXYUWOYNTOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN4O/c1-15-13-27(10-9-26(15)2)19-6-4-18(5-7-19)25-22-16(14-28)12-24-21-8-3-17(23)11-20(21)22/h3-8,11-12,15,28H,9-10,13-14H2,1-2H3,(H,24,25).
What are the key properties of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol?
[4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol has a molecular weight of 380.47 g/mol, XLogP of 3.75, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-6-fluoroquinolin-3-yl]methanol is sourced from PubChem (CID 10317643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).