C22H18N6O — CID 10317753
4-amino-6-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 10317753) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is 4-amino-6-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
| Compound Name | 4-amino-6-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
|---|---|
| PubChem CID | 10317753 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-amino-6-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | Nc1nc2c(NCc3ccccc3)cccc2n2c(=O)n(-c3ccccc3)nc12 |
| InChI | InChI=1S/C22H18N6O/c23-20-21-26-28(16-10-5-2-6-11-16)22(29)27(21)18-13-7-12-17(19(18)25-20)24-14-15-8-3-1-4-9-15/h1-13,24H,14H2,(H2,23,25) |
| InChIKey | WTPLIJMXPIILJW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |