C12H24O4 — CID 103181524
2-[2-(3-methoxypropoxy)ethyl]-2,3-dimethylbutanoic acid (PubChem CID 103181524) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethyl]-2,3-dimethylbutanoic acid.
| Compound Name | 2-[2-(3-methoxypropoxy)ethyl]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103181524 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethyl]-2,3-dimethylbutanoic acid |
| SMILES | COCCCOCCC(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C12H24O4/c1-10(2)12(3,11(13)14)6-9-16-8-5-7-15-4/h10H,5-9H2,1-4H3,(H,13,14) |
| InChIKey | LFUNDHQUOZDEBX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|