About 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol
1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol (PubChem CID 103182597) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol.
Molecular Properties
| Compound Name | 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol |
| PubChem CID | 103182597 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol |
| SMILES | Cc1cnc(CN2CCCC(C)(O)C2)c(C)c1N |
| InChI | InChI=1S/C14H23N3O/c1-10-7-16-12(11(2)13(10)15)8-17-6-4-5-14(3,18)9-17/h7,18H,4-6,8-9H2,1-3H3,(H2,15,16) |
| InChIKey | XPZUAKZDYPSPAF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol?
The IUPAC name of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol (CID 103182597) is 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol.
What is the SMILES notation for 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol?
The canonical SMILES for 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol is Cc1cnc(CN2CCCC(C)(O)C2)c(C)c1N.
What is the InChIKey of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol?
The InChIKey is XPZUAKZDYPSPAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-10-7-16-12(11(2)13(10)15)8-17-6-4-5-14(3,18)9-17/h7,18H,4-6,8-9H2,1-3H3,(H2,15,16).
What are the key properties of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol?
1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol has a molecular weight of 249.36 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-3-methylpiperidin-3-ol is sourced from PubChem (CID 103182597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).