About [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol
[4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol (PubChem CID 103182600) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol.
Molecular Properties
| Compound Name | [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol |
| PubChem CID | 103182600 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol |
| SMILES | Cc1cnc(CN2CCOCC2CO)c(C)c1N |
| InChI | InChI=1S/C13H21N3O2/c1-9-5-15-12(10(2)13(9)14)6-16-3-4-18-8-11(16)7-17/h5,11,17H,3-4,6-8H2,1-2H3,(H2,14,15) |
| InChIKey | HQFCPWLMLVVVCD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol?
The IUPAC name of [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol (CID 103182600) is [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol.
What is the SMILES notation for [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol?
The canonical SMILES for [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol is Cc1cnc(CN2CCOCC2CO)c(C)c1N.
What is the InChIKey of [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol?
The InChIKey is HQFCPWLMLVVVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-9-5-15-12(10(2)13(9)14)6-16-3-4-18-8-11(16)7-17/h5,11,17H,3-4,6-8H2,1-2H3,(H2,14,15).
What are the key properties of [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol?
[4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol has a molecular weight of 251.33 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]morpholin-3-yl]methanol is sourced from PubChem (CID 103182600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).