C17H27N3 — CID 103182604
2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3,5-dimethylpyridin-4-amine (PubChem CID 103182604) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3,5-dimethylpyridin-4-amine.
| Compound Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3,5-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 103182604 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3,5-dimethylpyridin-4-amine |
| SMILES | Cc1cnc(CN2CC=C(C(C)(C)C)CC2)c(C)c1N |
| InChI | InChI=1S/C17H27N3/c1-12-10-19-15(13(2)16(12)18)11-20-8-6-14(7-9-20)17(3,4)5/h6,10H,7-9,11H2,1-5H3,(H2,18,19) |
| InChIKey | SEUPVXTYVUJSQC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|