About 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione
1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione (PubChem CID 103182909) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione |
| PubChem CID | 103182909 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione |
| SMILES | Cc1cnc(CN2CC(=O)N(C)CC2=O)c(C)c1N |
| InChI | InChI=1S/C13H18N4O2/c1-8-4-15-10(9(2)13(8)14)5-17-7-11(18)16(3)6-12(17)19/h4H,5-7H2,1-3H3,(H2,14,15) |
| InChIKey | JUMDHTBLIKJESU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione?
The IUPAC name of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione (CID 103182909) is 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione.
What is the SMILES notation for 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione?
The canonical SMILES for 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione is Cc1cnc(CN2CC(=O)N(C)CC2=O)c(C)c1N.
What is the InChIKey of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione?
The InChIKey is JUMDHTBLIKJESU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c1-8-4-15-10(9(2)13(8)14)5-17-7-11(18)16(3)6-12(17)19/h4H,5-7H2,1-3H3,(H2,14,15).
What are the key properties of 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione?
1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione has a molecular weight of 262.31 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-3,5-dimethyl-2-pyridinyl)methyl]-4-methylpiperazine-2,5-dione is sourced from PubChem (CID 103182909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).