C22H37NO3Si — CID 10318316
[(Z,3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-hydroxyhex-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 10318316) has the molecular formula C22H37NO3Si and a molecular weight of 391.63 g/mol. Its IUPAC name is [(Z,3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-hydroxyhex-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-hydroxyhex-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 10318316 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [(Z,3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-hydroxyhex-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC[C@@H](O)[C@H](/C=C\OC(=O)N(C(C)C)C(C)C)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO3Si/c1-8-21(24)19(16-27(6,7)20-12-10-9-11-13-20)14-15-26-22(25)23(17(2)3)18(4)5/h9-15,17-19,21,24H,8,16H2,1-7H3/b15-14-/t19-,21-/m1/s1 |
| InChIKey | VTMILEMETOMALN-YJLOIDAESA-N |
| XLogP | 4.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|