C12H20N2S — CID 103183383
2-(butylsulfanylmethyl)-3,5-dimethylpyridin-4-amine (PubChem CID 103183383) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-(butylsulfanylmethyl)-3,5-dimethylpyridin-4-amine.
| Compound Name | 2-(butylsulfanylmethyl)-3,5-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 103183383 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(butylsulfanylmethyl)-3,5-dimethylpyridin-4-amine |
| SMILES | CCCCSCc1ncc(C)c(N)c1C |
| InChI | InChI=1S/C12H20N2S/c1-4-5-6-15-8-11-10(3)12(13)9(2)7-14-11/h7H,4-6,8H2,1-3H3,(H2,13,14) |
| InChIKey | FEGMHYVYKBRLCV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|