C25H28O2S — CID 10318379
(8R,9S,10R,13S,14S)-10,13-dimethyl-4-phenylsulfanyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10318379) has the molecular formula C25H28O2S and a molecular weight of 392.56 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-4-phenylsulfanyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4-phenylsulfanyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10318379 |
| Molecular Formula | C25H28O2S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4-phenylsulfanyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C(Sc3ccccc3)=C1C=C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H28O2S/c1-24-15-13-21(26)23(28-16-6-4-3-5-7-16)20(24)9-8-17-18-10-11-22(27)25(18,2)14-12-19(17)24/h3-9,17-19H,10-15H2,1-2H3/t17-,18-,19-,24+,25-/m0/s1 |
| InChIKey | CPXMJCCOZGKHHR-BKCLIDBKSA-N |
| XLogP | 5.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |