C14H15F7NO2P — CID 10318392
1-[ethoxy(methyl)phosphoryl]-2,2,3,3,4,4,4-heptafluoro-N-(4-methylphenyl)butan-1-imine (PubChem CID 10318392) has the molecular formula C14H15F7NO2P and a molecular weight of 393.24 g/mol. Its IUPAC name is 1-[ethoxy(methyl)phosphoryl]-2,2,3,3,4,4,4-heptafluoro-N-(4-methylphenyl)butan-1-imine.
| Compound Name | 1-[ethoxy(methyl)phosphoryl]-2,2,3,3,4,4,4-heptafluoro-N-(4-methylphenyl)butan-1-imine |
|---|---|
| PubChem CID | 10318392 |
| Molecular Formula | C14H15F7NO2P |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 1-[ethoxy(methyl)phosphoryl]-2,2,3,3,4,4,4-heptafluoro-N-(4-methylphenyl)butan-1-imine |
| SMILES | CCOP(C)(=O)/C(=N\c1ccc(C)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F7NO2P/c1-4-24-25(3,23)11(22-10-7-5-9(2)6-8-10)12(15,16)13(17,18)14(19,20)21/h5-8H,4H2,1-3H3/b22-11- |
| InChIKey | XAACLYDFNKQUAI-JJFYIABZSA-N |
| XLogP | 5.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|