C22H34O6 — CID 10318490
1-O-ethyl 6-O-methyl (1S,2S,4aR,6S,8S,8aS)-8-(2,2-dimethylbutanoyloxy)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate (PubChem CID 10318490) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1-O-ethyl 6-O-methyl (1S,2S,4aR,6S,8S,8aS)-8-(2,2-dimethylbutanoyloxy)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate.
| Compound Name | 1-O-ethyl 6-O-methyl (1S,2S,4aR,6S,8S,8aS)-8-(2,2-dimethylbutanoyloxy)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 10318490 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-O-ethyl 6-O-methyl (1S,2S,4aR,6S,8S,8aS)-8-(2,2-dimethylbutanoyloxy)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2[C@@H](OC(=O)C(C)(C)CC)C[C@@H](C(=O)OC)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C22H34O6/c1-7-22(4,5)21(25)28-16-12-15(19(23)26-6)11-14-10-9-13(3)17(18(14)16)20(24)27-8-2/h9-10,13-18H,7-8,11-12H2,1-6H3/t13-,14-,15-,16-,17-,18+/m0/s1 |
| InChIKey | FWUGAYIVLBIOOR-UGDFAFBOSA-N |
| XLogP | 3.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|