C23H27ClN4 — CID 10318507
7-chloro-N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3-dimethylquinolin-4-amine (PubChem CID 10318507) has the molecular formula C23H27ClN4 and a molecular weight of 394.95 g/mol. Its IUPAC name is 7-chloro-N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3-dimethylquinolin-4-amine.
| Compound Name | 7-chloro-N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 10318507 |
| Molecular Formula | C23H27ClN4 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 7-chloro-N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3-dimethylquinolin-4-amine |
| SMILES | Cc1nc2cc(Cl)ccc2c(Nc2ccc(N3CCN(C)C(C)C3)cc2)c1C |
| InChI | InChI=1S/C23H27ClN4/c1-15-14-28(12-11-27(15)4)20-8-6-19(7-9-20)26-23-16(2)17(3)25-22-13-18(24)5-10-21(22)23/h5-10,13,15H,11-12,14H2,1-4H3,(H,25,26) |
| InChIKey | QRWKSCTWTCHDII-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|