C9H20O4 — CID 103185077
2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol (PubChem CID 103185077) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol.
| Compound Name | 2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 103185077 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol |
| SMILES | COCCCOCCC(CO)CO |
| InChI | InChI=1S/C9H20O4/c1-12-4-2-5-13-6-3-9(7-10)8-11/h9-11H,2-8H2,1H3 |
| InChIKey | JNKRALXHKSLXCB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|