C13H21IN2O4 — CID 103185199
5-iodo-3-[2-(3-methoxypropoxy)ethyl]-1-propylpyrimidine-2,4-dione (PubChem CID 103185199) has the molecular formula C13H21IN2O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is 5-iodo-3-[2-(3-methoxypropoxy)ethyl]-1-propylpyrimidine-2,4-dione.
| Compound Name | 5-iodo-3-[2-(3-methoxypropoxy)ethyl]-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103185199 |
| Molecular Formula | C13H21IN2O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 5-iodo-3-[2-(3-methoxypropoxy)ethyl]-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1cc(I)c(=O)n(CCOCCCOC)c1=O |
| InChI | InChI=1S/C13H21IN2O4/c1-3-5-15-10-11(14)12(17)16(13(15)18)6-9-20-8-4-7-19-2/h10H,3-9H2,1-2H3 |
| InChIKey | OWCBPMOKFSHNMJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|