About (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid
(E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid (PubChem CID 10318526) has the molecular formula C26H21NO3
and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid |
| PubChem CID | 10318526 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C26H21NO3/c28-24(29)17-15-20-9-7-8-19(18-20)14-16-23-27-25(21-10-3-1-4-11-21)26(30-23)22-12-5-2-6-13-22/h1-13,15,17-18H,14,16H2,(H,28,29)/b17-15+ |
| InChIKey | IZHZPDKBXGBNHV-BMRADRMJSA-N |
| XLogP | 5.89 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid (CID 10318526) is (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid is O=C(O)/C=C/c1cccc(CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)c1.
What is the InChIKey of (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid?
The InChIKey is IZHZPDKBXGBNHV-BMRADRMJSA-N. The full InChI is InChI=1S/C26H21NO3/c28-24(29)17-15-20-9-7-8-19(18-20)14-16-23-27-25(21-10-3-1-4-11-21)26(30-23)22-12-5-2-6-13-22/h1-13,15,17-18H,14,16H2,(H,28,29)/b17-15+.
What are the key properties of (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid?
(E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid has a molecular weight of 395.46 g/mol, XLogP of 5.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenyl]prop-2-enoic acid is sourced from PubChem (CID 10318526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).