C13H18N2O4S — CID 103185378
methyl 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]butanoate (PubChem CID 103185378) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]butanoate.
| Compound Name | methyl 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 103185378 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]butanoate |
| SMILES | COC(=O)CC(C)SCc1ncc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H18N2O4S/c1-8-6-14-11(10(3)13(8)15(17)18)7-20-9(2)5-12(16)19-4/h6,9H,5,7H2,1-4H3 |
| InChIKey | PWBZLZCAGJFFRE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|