C12H15N3O2 — CID 103185915
N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]but-3-yn-2-amine (PubChem CID 103185915) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]but-3-yn-2-amine.
| Compound Name | N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 103185915 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCc1ncc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H15N3O2/c1-5-9(3)13-7-11-10(4)12(15(16)17)8(2)6-14-11/h1,6,9,13H,7H2,2-4H3 |
| InChIKey | OUPRJNUNMAKBDX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|