C12H12ClN5O3 — CID 103186920
8-(6-chloropyrazine-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 103186920) has the molecular formula C12H12ClN5O3 and a molecular weight of 309.71 g/mol. Its IUPAC name is 8-(6-chloropyrazine-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(6-chloropyrazine-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 103186920 |
| Molecular Formula | C12H12ClN5O3 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 8-(6-chloropyrazine-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3cncc(Cl)n3)CC2)N1 |
| InChI | InChI=1S/C12H12ClN5O3/c13-8-6-14-5-7(15-8)9(19)18-3-1-12(2-4-18)10(20)16-11(21)17-12/h5-6H,1-4H2,(H2,16,17,20,21) |
| InChIKey | KNPDDWXJLWHJBY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|