C12H23N5O — CID 103187371
4-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-methylpyrazole-3-carboxamide (PubChem CID 103187371) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103187371 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 4-amino-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-1-methylpyrazole-3-carboxamide |
| SMILES | CCN(C(=O)c1nn(C)cc1N)C(C)CN(C)C |
| InChI | InChI=1S/C12H23N5O/c1-6-17(9(2)7-15(3)4)12(18)11-10(13)8-16(5)14-11/h8-9H,6-7,13H2,1-5H3 |
| InChIKey | BYLNONWSLHIVHB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |