C15H34N4O — CID 103188107
4-amino-N-tert-butyl-3-[1-(dimethylamino)propan-2-yl-ethylamino]butanamide (PubChem CID 103188107) has the molecular formula C15H34N4O and a molecular weight of 286.46 g/mol. Its IUPAC name is 4-amino-N-tert-butyl-3-[1-(dimethylamino)propan-2-yl-ethylamino]butanamide.
| Compound Name | 4-amino-N-tert-butyl-3-[1-(dimethylamino)propan-2-yl-ethylamino]butanamide |
|---|---|
| PubChem CID | 103188107 |
| Molecular Formula | C15H34N4O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 4-amino-N-tert-butyl-3-[1-(dimethylamino)propan-2-yl-ethylamino]butanamide |
| SMILES | CCN(C(C)CN(C)C)C(CN)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H34N4O/c1-8-19(12(2)11-18(6)7)13(10-16)9-14(20)17-15(3,4)5/h12-13H,8-11,16H2,1-7H3,(H,17,20) |
| InChIKey | ZMMPRQZUNGJEPY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |